About 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride
2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride (PubChem CID 84710258) has the molecular formula C10H9ClO4S
and a molecular weight of 260.70 g/mol. Its IUPAC name is 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride.
Analyze 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride?
The IUPAC name of 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride (CID 84710258) is 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride.
What is the SMILES notation for 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride?
The canonical SMILES for 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride is O=S(=O)(Cl)c1cc2c(c3c1CCO3)OCC2.
What is the InChIKey of 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride?
The InChIKey is XJLHXRPBZJCMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO4S/c11-16(12,13)8-5-6-1-3-14-9(6)10-7(8)2-4-15-10/h5H,1-4H2.
What are the key properties of 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride?
2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride has a molecular weight of 260.70 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6,7-tetrahydrofuro[3,2-g][1]benzofuran-4-sulfonyl chloride is sourced from PubChem (CID 84710258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).