C13H14Cl2O4S — CID 58737227
5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-sulfonyl chloride (PubChem CID 58737227) has the molecular formula C13H14Cl2O4S and a molecular weight of 337.22 g/mol. Its IUPAC name is 5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-sulfonyl chloride.
| Compound Name | 5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
|---|---|
| PubChem CID | 58737227 |
| Molecular Formula | C13H14Cl2O4S |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-sulfonyl chloride |
| SMILES | O=C(CCCCCl)c1cc2c(c(S(=O)(=O)Cl)c1)OCC2 |
| InChI | InChI=1S/C13H14Cl2O4S/c14-5-2-1-3-11(16)10-7-9-4-6-19-13(9)12(8-10)20(15,17)18/h7-8H,1-6H2 |
| InChIKey | AUDZEBKHUAMWGC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|