C14H18ClNO4S — CID 58870445
N-[5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-yl]methanesulfonamide (PubChem CID 58870445) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is N-[5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-yl]methanesulfonamide.
| Compound Name | N-[5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 58870445 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[5-(5-chloropentanoyl)-2,3-dihydro-1-benzofuran-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)CCCCCl)cc2c1OCC2 |
| InChI | InChI=1S/C14H18ClNO4S/c1-21(18,19)16-12-9-11(13(17)4-2-3-6-15)8-10-5-7-20-14(10)12/h8-9,16H,2-7H2,1H3 |
| InChIKey | ZSJMWIDZTWRKND-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|