7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride

C10H9ClO5S — CID 43118893

IUPAC7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride
SMILESCC(=O)c1cc2c(c(S(=O)(=O)Cl)c1)OCCO2
InChIInChI=1S/C10H9ClO5S/c1-6(12)7-4-8-10(16-3-2-15-8)9(5-7)17(11,13)14/h4-5H,2-3H2,1H3
InChIKeyIZTUDUMTCWTMFV-UHFFFAOYSA-N
MW276.70 g/mol
LogP1.59
Rot. Bonds2

About 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride

7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride (PubChem CID 43118893) has the molecular formula C10H9ClO5S and a molecular weight of 276.70 g/mol. Its IUPAC name is 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride.

Molecular Properties

Compound Name7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride
PubChem CID43118893
Molecular FormulaC10H9ClO5S
Molecular Weight276.70 g/mol
Exact Mass275.99
IUPAC Name7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride
SMILESCC(=O)c1cc2c(c(S(=O)(=O)Cl)c1)OCCO2
InChIInChI=1S/C10H9ClO5S/c1-6(12)7-4-8-10(16-3-2-15-8)9(5-7)17(11,13)14/h4-5H,2-3H2,1H3
InChIKeyIZTUDUMTCWTMFV-UHFFFAOYSA-N
XLogP1.59
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.70
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride?
The IUPAC name of 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride (CID 43118893) is 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride.
What is the SMILES notation for 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride?
The canonical SMILES for 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride is CC(=O)c1cc2c(c(S(=O)(=O)Cl)c1)OCCO2.
What is the InChIKey of 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride?
The InChIKey is IZTUDUMTCWTMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO5S/c1-6(12)7-4-8-10(16-3-2-15-8)9(5-7)17(11,13)14/h4-5H,2-3H2,1H3.
What are the key properties of 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride?
7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride has a molecular weight of 276.70 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-acetyl-2,3-dihydro-1,4-benzodioxine-5-sulfonyl chloride is sourced from PubChem (CID 43118893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).