7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride

C9H9ClO4S2 — CID 116684826

IUPAC7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride
SMILESCSc1cc2c(cc1S(=O)(=O)Cl)OCCO2
InChIInChI=1S/C9H9ClO4S2/c1-15-8-4-6-7(14-3-2-13-6)5-9(8)16(10,11)12/h4-5H,2-3H2,1H3
InChIKeyQDYSNZAJOYSUGB-UHFFFAOYSA-N
MW280.75 g/mol
LogP2.11
Rot. Bonds2

About 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride

7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride (PubChem CID 116684826) has the molecular formula C9H9ClO4S2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride.

Molecular Properties

Compound Name7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride
PubChem CID116684826
Molecular FormulaC9H9ClO4S2
Molecular Weight280.75 g/mol
Exact Mass279.96
IUPAC Name7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride
SMILESCSc1cc2c(cc1S(=O)(=O)Cl)OCCO2
InChIInChI=1S/C9H9ClO4S2/c1-15-8-4-6-7(14-3-2-13-6)5-9(8)16(10,11)12/h4-5H,2-3H2,1H3
InChIKeyQDYSNZAJOYSUGB-UHFFFAOYSA-N
XLogP2.11
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.75
LogP ≤ 52.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
The IUPAC name of 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride (CID 116684826) is 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride.
What is the SMILES notation for 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
The canonical SMILES for 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride is CSc1cc2c(cc1S(=O)(=O)Cl)OCCO2.
What is the InChIKey of 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
The InChIKey is QDYSNZAJOYSUGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO4S2/c1-15-8-4-6-7(14-3-2-13-6)5-9(8)16(10,11)12/h4-5H,2-3H2,1H3.
What are the key properties of 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride?
7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride has a molecular weight of 280.75 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride is sourced from PubChem (CID 116684826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).