C10H13NO2S — CID 130607978
N-methyl-6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 130607978) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is N-methyl-6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | N-methyl-6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 130607978 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | N-methyl-6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | CNc1cc2c(cc1SC)OCCO2 |
| InChI | InChI=1S/C10H13NO2S/c1-11-7-5-8-9(6-10(7)14-2)13-4-3-12-8/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | FVARUVNGQNZHJO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|