C16H24N2O3S — CID 119764658
7-amino-N-(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)heptanamide (PubChem CID 119764658) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 7-amino-N-(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)heptanamide.
| Compound Name | 7-amino-N-(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)heptanamide |
|---|---|
| PubChem CID | 119764658 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 7-amino-N-(6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-yl)heptanamide |
| SMILES | CSc1cc2c(cc1NC(=O)CCCCCCN)OCCO2 |
| InChI | InChI=1S/C16H24N2O3S/c1-22-15-11-14-13(20-8-9-21-14)10-12(15)18-16(19)6-4-2-3-5-7-17/h10-11H,2-9,17H2,1H3,(H,18,19) |
| InChIKey | VJUNSMWFCQNZEN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|