About 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid
6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid (PubChem CID 83814911) has the molecular formula C10H10O4S
and a molecular weight of 226.25 g/mol. Its IUPAC name is 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid.
Analyze 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid?
The IUPAC name of 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid (CID 83814911) is 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid.
What is the SMILES notation for 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid?
The canonical SMILES for 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid is CSc1cc2c(cc1C(=O)O)OCCO2.
What is the InChIKey of 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid?
The InChIKey is DTIBGFDPDSNHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4S/c1-15-9-5-8-7(13-2-3-14-8)4-6(9)10(11)12/h4-5H,2-3H2,1H3,(H,11,12).
What are the key properties of 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid?
6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid has a molecular weight of 226.25 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid is sourced from PubChem (CID 83814911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).