About sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride
sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride (PubChem CID 22351930) has the molecular formula C8H7ClNaO3S2+
and a molecular weight of 273.72 g/mol. Its IUPAC name is sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride |
| PubChem CID | 22351930 |
| Molecular Formula | C8H7ClNaO3S2+ |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 272.94 |
| IUPAC Name | sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride |
| SMILES | CC(=O)c1ccc(S)c(S(=O)(=O)Cl)c1.[Na+] |
| InChI | InChI=1S/C8H7ClO3S2.Na/c1-5(10)6-2-3-7(13)8(4-6)14(9,11)12;/h2-4,13H,1H3;/q;+1 |
| InChIKey | ZRWJTBQIDQQLQH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride?
The IUPAC name of sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride (CID 22351930) is sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride.
What is the SMILES notation for sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride?
The canonical SMILES for sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride is CC(=O)c1ccc(S)c(S(=O)(=O)Cl)c1.[Na+].
What is the InChIKey of sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride?
The InChIKey is ZRWJTBQIDQQLQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO3S2.Na/c1-5(10)6-2-3-7(13)8(4-6)14(9,11)12;/h2-4,13H,1H3;/q;+1.
What are the key properties of sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride?
sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride has a molecular weight of 273.72 g/mol, XLogP of -0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-acetyl-2-sulfanylbenzenesulfonyl chloride is sourced from PubChem (CID 22351930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).