C8H8OS2 — CID 158371144
1-[3,4-bis(sulfanyl)phenyl]ethanone (PubChem CID 158371144) has the molecular formula C8H8OS2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-[3,4-bis(sulfanyl)phenyl]ethanone.
| Compound Name | 1-[3,4-bis(sulfanyl)phenyl]ethanone |
|---|---|
| PubChem CID | 158371144 |
| Molecular Formula | C8H8OS2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 1-[3,4-bis(sulfanyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(S)c(S)c1 |
| InChI | InChI=1S/C8H8OS2/c1-5(9)6-2-3-7(10)8(11)4-6/h2-4,10-11H,1H3 |
| InChIKey | YUNLPIDSJSCNPC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|