C9H6ClNO4 — CID 130038992
6-chloro-8-nitro-2,3-dihydrochromen-4-one (PubChem CID 130038992) has the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. Its IUPAC name is 6-chloro-8-nitro-2,3-dihydrochromen-4-one.
| Compound Name | 6-chloro-8-nitro-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 130038992 |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 6-chloro-8-nitro-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2c1cc(Cl)cc2[N+](=O)[O-] |
| InChI | InChI=1S/C9H6ClNO4/c10-5-3-6-8(12)1-2-15-9(6)7(4-5)11(13)14/h3-4H,1-2H2 |
| InChIKey | JENQZRPLYFSTLO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|