C10H9FO3 — CID 156871065
6-fluoro-7-hydroxy-8-methyl-2,3-dihydrochromen-4-one (PubChem CID 156871065) has the molecular formula C10H9FO3 and a molecular weight of 196.18 g/mol. Its IUPAC name is 6-fluoro-7-hydroxy-8-methyl-2,3-dihydrochromen-4-one.
| Compound Name | 6-fluoro-7-hydroxy-8-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 156871065 |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 6-fluoro-7-hydroxy-8-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1c(O)c(F)cc2c1OCCC2=O |
| InChI | InChI=1S/C10H9FO3/c1-5-9(13)7(11)4-6-8(12)2-3-14-10(5)6/h4,13H,2-3H2,1H3 |
| InChIKey | ULFXKGOXQDAVPW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |