About (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite
(6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite (PubChem CID 175013196) has the molecular formula C9H6ClFO2S
and a molecular weight of 232.66 g/mol. Its IUPAC name is (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite.
Analyze (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite?
The IUPAC name of (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite (CID 175013196) is (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite.
What is the SMILES notation for (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite?
The canonical SMILES for (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite is O=C1CCOc2c(SCl)cc(F)cc21.
What is the InChIKey of (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite?
The InChIKey is ANYWMWJRUSGXCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClFO2S/c10-14-8-4-5(11)3-6-7(12)1-2-13-9(6)8/h3-4H,1-2H2.
What are the key properties of (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite?
(6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite has a molecular weight of 232.66 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-4-oxo-2,3-dihydrochromen-8-yl) thiohypochlorite is sourced from PubChem (CID 175013196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).