C11H12O2S2 — CID 175565086
6,8-bis(methylsulfanyl)-2,3-dihydrochromen-4-one (PubChem CID 175565086) has the molecular formula C11H12O2S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 6,8-bis(methylsulfanyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6,8-bis(methylsulfanyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 175565086 |
| Molecular Formula | C11H12O2S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 6,8-bis(methylsulfanyl)-2,3-dihydrochromen-4-one |
| SMILES | CSc1cc(SC)c2c(c1)C(=O)CCO2 |
| InChI | InChI=1S/C11H12O2S2/c1-14-7-5-8-9(12)3-4-13-11(8)10(6-7)15-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | PBGIACCJQGFUKW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |