About 5-fluoro-8-methyl-2,3-dihydrochromen-4-one
5-fluoro-8-methyl-2,3-dihydrochromen-4-one (PubChem CID 55273706) has the molecular formula C10H9FO2
and a molecular weight of 180.18 g/mol. Its IUPAC name is 5-fluoro-8-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 5-fluoro-8-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 55273706 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 5-fluoro-8-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc(F)c2c1OCCC2=O |
| InChI | InChI=1S/C10H9FO2/c1-6-2-3-7(11)9-8(12)4-5-13-10(6)9/h2-3H,4-5H2,1H3 |
| InChIKey | VRJKUICDXFOTTO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-8-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-8-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 5-fluoro-8-methyl-2,3-dihydrochromen-4-one (CID 55273706) is 5-fluoro-8-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 5-fluoro-8-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 5-fluoro-8-methyl-2,3-dihydrochromen-4-one is Cc1ccc(F)c2c1OCCC2=O.
What is the InChIKey of 5-fluoro-8-methyl-2,3-dihydrochromen-4-one?
The InChIKey is VRJKUICDXFOTTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO2/c1-6-2-3-7(11)9-8(12)4-5-13-10(6)9/h2-3H,4-5H2,1H3.
What are the key properties of 5-fluoro-8-methyl-2,3-dihydrochromen-4-one?
5-fluoro-8-methyl-2,3-dihydrochromen-4-one has a molecular weight of 180.18 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-8-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 55273706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).