C10H10O3S — CID 156871270
8-methyl-7-sulfanyloxy-2,3-dihydrochromen-4-one (PubChem CID 156871270) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 8-methyl-7-sulfanyloxy-2,3-dihydrochromen-4-one.
| Compound Name | 8-methyl-7-sulfanyloxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 156871270 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 8-methyl-7-sulfanyloxy-2,3-dihydrochromen-4-one |
| SMILES | Cc1c(OS)ccc2c1OCCC2=O |
| InChI | InChI=1S/C10H10O3S/c1-6-9(13-14)3-2-7-8(11)4-5-12-10(6)7/h2-3,14H,4-5H2,1H3 |
| InChIKey | PGGIHXFTOFROAU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|