About 4-chloro-2,6-dinitrophenolate
4-chloro-2,6-dinitrophenolate (PubChem CID 36690453) has the molecular formula C6H2ClN2O5-
and a molecular weight of 217.54 g/mol. Its IUPAC name is 4-chloro-2,6-dinitrophenolate.
Molecular Properties
| Compound Name | 4-chloro-2,6-dinitrophenolate |
| PubChem CID | 36690453 |
| Molecular Formula | C6H2ClN2O5- |
| Molecular Weight | 217.54 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 4-chloro-2,6-dinitrophenolate |
| SMILES | O=[N+]([O-])c1cc(Cl)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C6H3ClN2O5/c7-3-1-4(8(11)12)6(10)5(2-3)9(13)14/h1-2,10H/p-1 |
| InChIKey | KESYALTWUAFAAC-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 109.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,6-dinitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-dinitrophenolate?
The IUPAC name of 4-chloro-2,6-dinitrophenolate (CID 36690453) is 4-chloro-2,6-dinitrophenolate.
What is the SMILES notation for 4-chloro-2,6-dinitrophenolate?
The canonical SMILES for 4-chloro-2,6-dinitrophenolate is O=[N+]([O-])c1cc(Cl)cc([N+](=O)[O-])c1[O-].
What is the InChIKey of 4-chloro-2,6-dinitrophenolate?
The InChIKey is KESYALTWUAFAAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H3ClN2O5/c7-3-1-4(8(11)12)6(10)5(2-3)9(13)14/h1-2,10H/p-1.
What are the key properties of 4-chloro-2,6-dinitrophenolate?
4-chloro-2,6-dinitrophenolate has a molecular weight of 217.54 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-dinitrophenolate is sourced from PubChem (CID 36690453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).