C5HCl2N3O4 — CID 71429452
2,3-dichloro-4,6-dinitropyridine (PubChem CID 71429452) has the molecular formula C5HCl2N3O4 and a molecular weight of 237.99 g/mol. Its IUPAC name is 2,3-dichloro-4,6-dinitropyridine.
| Compound Name | 2,3-dichloro-4,6-dinitropyridine |
|---|---|
| PubChem CID | 71429452 |
| Molecular Formula | C5HCl2N3O4 |
| Molecular Weight | 237.99 g/mol |
| Exact Mass | 236.93 |
| IUPAC Name | 2,3-dichloro-4,6-dinitropyridine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c(Cl)n1 |
| InChI | InChI=1S/C5HCl2N3O4/c6-4-2(9(11)12)1-3(10(13)14)8-5(4)7/h1H |
| InChIKey | JGHWUIPUHDQBSP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.99 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|