C9H9BrN2O3 — CID 131600145
(4S)-8-bromo-6-nitro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 131600145) has the molecular formula C9H9BrN2O3 and a molecular weight of 273.09 g/mol. Its IUPAC name is (4S)-8-bromo-6-nitro-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-8-bromo-6-nitro-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 131600145 |
| Molecular Formula | C9H9BrN2O3 |
| Molecular Weight | 273.09 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | (4S)-8-bromo-6-nitro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@H]1CCOc2c(Br)cc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C9H9BrN2O3/c10-7-4-5(12(13)14)3-6-8(11)1-2-15-9(6)7/h3-4,8H,1-2,11H2/t8-/m0/s1 |
| InChIKey | UJQODHAIFMTDFM-QMMMGPOBSA-N |
| XLogP | 2.14 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.09 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|