C9H10BrClN2O3 — CID 171252428
(4R)-5-bromo-8-nitro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (PubChem CID 171252428) has the molecular formula C9H10BrClN2O3 and a molecular weight of 309.55 g/mol. Its IUPAC name is (4R)-5-bromo-8-nitro-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
| Compound Name | (4R)-5-bromo-8-nitro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
|---|---|
| PubChem CID | 171252428 |
| Molecular Formula | C9H10BrClN2O3 |
| Molecular Weight | 309.55 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | (4R)-5-bromo-8-nitro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCOc2c([N+](=O)[O-])ccc(Br)c21 |
| InChI | InChI=1S/C9H9BrN2O3.ClH/c10-5-1-2-7(12(13)14)9-8(5)6(11)3-4-15-9;/h1-2,6H,3-4,11H2;1H/t6-;/m1./s1 |
| InChIKey | WFIWMHHBUKBRAG-FYZOBXCZSA-N |
| XLogP | 2.56 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|