C8H7ClN2O3 — CID 130707398
(3R)-7-chloro-4-nitro-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130707398) has the molecular formula C8H7ClN2O3 and a molecular weight of 214.61 g/mol. Its IUPAC name is (3R)-7-chloro-4-nitro-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3R)-7-chloro-4-nitro-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 130707398 |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | (3R)-7-chloro-4-nitro-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | N[C@H]1COc2c(Cl)ccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C8H7ClN2O3/c9-4-1-2-6(11(12)13)7-5(10)3-14-8(4)7/h1-2,5H,3,10H2/t5-/m0/s1 |
| InChIKey | OOWVYELYCVNKKA-YFKPBYRVSA-N |
| XLogP | 1.64 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|