C8H8N2O3 — CID 130686465
(3R)-7-nitro-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130686465) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is (3R)-7-nitro-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3R)-7-nitro-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 130686465 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (3R)-7-nitro-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | N[C@H]1COc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N2O3/c9-6-4-13-8-5(6)2-1-3-7(8)10(11)12/h1-3,6H,4,9H2/t6-/m0/s1 |
| InChIKey | RVRFTRCGXUZLCC-LURJTMIESA-N |
| XLogP | 0.99 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|