C6H3NO3 — CID 21467393
2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 21467393) has the molecular formula C6H3NO3 and a molecular weight of 137.09 g/mol. Its IUPAC name is 2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 21467393 |
| Molecular Formula | C6H3NO3 |
| Molecular Weight | 137.09 g/mol |
| Exact Mass | 137.01 |
| IUPAC Name | 2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | O=[N+]([O-])c1cccc2c1O2 |
| InChI | InChI=1S/C6H3NO3/c8-7(9)4-2-1-3-5-6(4)10-5/h1-3H |
| InChIKey | SFEBELBWNVJZBO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.09 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|