C12H18N2O3 — CID 21467392
hexan-1-amine;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 21467392) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is hexan-1-amine;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | hexan-1-amine;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 21467392 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | hexan-1-amine;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CCCCCCN.O=[N+]([O-])c1cccc2c1O2 |
| InChI | InChI=1S/C6H3NO3.C6H15N/c8-7(9)4-2-1-3-5-6(4)10-5;1-2-3-4-5-6-7/h1-3H;2-7H2,1H3 |
| InChIKey | AXTXZUJDEGVAEK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|