C8H9NO3 — CID 174816441
ethane;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 174816441) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is ethane;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | ethane;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 174816441 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | ethane;2-nitro-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CC.O=[N+]([O-])c1cccc2c1O2 |
| InChI | InChI=1S/C6H3NO3.C2H6/c8-7(9)4-2-1-3-5-6(4)10-5;1-2/h1-3H;1-2H3 |
| InChIKey | ABVCUSOQPMJETN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|