C24H18NO4Sb — CID 134879935
4-nitro-2,2,2-triphenyl-1,3,2λ5-benzodioxastibole (PubChem CID 134879935) has the molecular formula C24H18NO4Sb and a molecular weight of 506.17 g/mol. Its IUPAC name is 4-nitro-2,2,2-triphenyl-1,3,2λ5-benzodioxastibole.
| Compound Name | 4-nitro-2,2,2-triphenyl-1,3,2λ5-benzodioxastibole |
|---|---|
| PubChem CID | 134879935 |
| Molecular Formula | C24H18NO4Sb |
| Molecular Weight | 506.17 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | 4-nitro-2,2,2-triphenyl-1,3,2λ5-benzodioxastibole |
| SMILES | O=[N+]([O-])c1cccc2c1O[Sb](c1ccccc1)(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C6H5NO4.3C6H5.Sb/c8-5-3-1-2-4(6(5)9)7(10)11;3*1-2-4-6-5-3-1;/h1-3,8-9H;3*1-5H;/q;;;;+2/p-2 |
| InChIKey | YJLDANMXRPLHDS-UHFFFAOYSA-L |
| XLogP | 3.48 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|