C18H15N3O2 — CID 23118944
2-(2-nitrophenyl)-1,1-diphenylhydrazine (PubChem CID 23118944) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1,1-diphenylhydrazine.
| Compound Name | 2-(2-nitrophenyl)-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 23118944 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(2-nitrophenyl)-1,1-diphenylhydrazine |
| SMILES | O=[N+]([O-])c1ccccc1NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O2/c22-21(23)18-14-8-7-13-17(18)19-20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H |
| InChIKey | OOGRUTOHZHXHND-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|