C16H13N5O2 — CID 3090119
2-(5-nitropyrimidin-2-yl)-1,1-diphenylhydrazine (PubChem CID 3090119) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(5-nitropyrimidin-2-yl)-1,1-diphenylhydrazine.
| Compound Name | 2-(5-nitropyrimidin-2-yl)-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 3090119 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-(5-nitropyrimidin-2-yl)-1,1-diphenylhydrazine |
| SMILES | O=[N+]([O-])c1cnc(NN(c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C16H13N5O2/c22-21(23)15-11-17-16(18-12-15)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H,(H,17,18,19) |
| InChIKey | ICMVLUVYZZUSSI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|