C15H10N6O6S — CID 23118903
1-phenyl-1-(1,3-thiazol-2-yl)-2-(2,4,6-trinitrophenyl)hydrazine (PubChem CID 23118903) has the molecular formula C15H10N6O6S and a molecular weight of 402.35 g/mol. Its IUPAC name is 1-phenyl-1-(1,3-thiazol-2-yl)-2-(2,4,6-trinitrophenyl)hydrazine.
| Compound Name | 1-phenyl-1-(1,3-thiazol-2-yl)-2-(2,4,6-trinitrophenyl)hydrazine |
|---|---|
| PubChem CID | 23118903 |
| Molecular Formula | C15H10N6O6S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 1-phenyl-1-(1,3-thiazol-2-yl)-2-(2,4,6-trinitrophenyl)hydrazine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NN(c2ccccc2)c2nccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10N6O6S/c22-19(23)11-8-12(20(24)25)14(13(9-11)21(26)27)17-18(15-16-6-7-28-15)10-4-2-1-3-5-10/h1-9,17H |
| InChIKey | LJRPHWJMPMIFHX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|