C24H17N5O6 — CID 54248221
1,2-diphenyl-1-[2-(2,4,6-trinitrophenyl)phenyl]hydrazine (PubChem CID 54248221) has the molecular formula C24H17N5O6 and a molecular weight of 471.43 g/mol. Its IUPAC name is 1,2-diphenyl-1-[2-(2,4,6-trinitrophenyl)phenyl]hydrazine.
| Compound Name | 1,2-diphenyl-1-[2-(2,4,6-trinitrophenyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 54248221 |
| Molecular Formula | C24H17N5O6 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 1,2-diphenyl-1-[2-(2,4,6-trinitrophenyl)phenyl]hydrazine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(-c2ccccc2N(Nc2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17N5O6/c30-27(31)19-15-22(28(32)33)24(23(16-19)29(34)35)20-13-7-8-14-21(20)26(18-11-5-2-6-12-18)25-17-9-3-1-4-10-17/h1-16,25H |
| InChIKey | QUVMROKCZBMCDH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|