C19H14N4O5 — CID 56698403
2,4-dinitro-N',N'-diphenylbenzohydrazide (PubChem CID 56698403) has the molecular formula C19H14N4O5 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2,4-dinitro-N',N'-diphenylbenzohydrazide.
| Compound Name | 2,4-dinitro-N',N'-diphenylbenzohydrazide |
|---|---|
| PubChem CID | 56698403 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2,4-dinitro-N',N'-diphenylbenzohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccccc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N4O5/c24-19(17-12-11-16(22(25)26)13-18(17)23(27)28)20-21(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H,(H,20,24) |
| InChIKey | YBLSWNQOGCYBJQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|