C28H21N7O5 — CID 135650486
(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N',N'-diphenylacetohydrazide (PubChem CID 135650486) has the molecular formula C28H21N7O5 and a molecular weight of 535.52 g/mol. Its IUPAC name is (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N',N'-diphenylacetohydrazide.
| Compound Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 135650486 |
| Molecular Formula | C28H21N7O5 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N',N'-diphenylacetohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccccc1)/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H21N7O5/c36-28(32-33(19-9-3-1-4-10-19)20-11-5-2-6-12-20)27(23-18-29-24-14-8-7-13-22(23)24)31-30-25-16-15-21(34(37)38)17-26(25)35(39)40/h1-18,29-30H,(H,32,36)/b31-27- |
| InChIKey | HJHDCEQCNMSTGF-QVTSOHHYSA-N |
| XLogP | 5.67 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|