C22H16N6O5 — CID 135665102
(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N-phenylacetamide (PubChem CID 135665102) has the molecular formula C22H16N6O5 and a molecular weight of 444.41 g/mol. Its IUPAC name is (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N-phenylacetamide.
| Compound Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 135665102 |
| Molecular Formula | C22H16N6O5 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-(1H-indol-3-yl)-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1)/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H16N6O5/c29-22(24-14-6-2-1-3-7-14)21(17-13-23-18-9-5-4-8-16(17)18)26-25-19-11-10-15(27(30)31)12-20(19)28(32)33/h1-13,23,25H,(H,24,29)/b26-21- |
| InChIKey | VMCYWPNVDOJHSB-QLYXXIJNSA-N |
| XLogP | 4.44 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|