C19H12N6O7 — CID 87086050
1-(1,3-benzoxazol-2-yl)-1-phenyl-2-(2,4,6-trinitrophenyl)hydrazine (PubChem CID 87086050) has the molecular formula C19H12N6O7 and a molecular weight of 436.34 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-1-phenyl-2-(2,4,6-trinitrophenyl)hydrazine.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-1-phenyl-2-(2,4,6-trinitrophenyl)hydrazine |
|---|---|
| PubChem CID | 87086050 |
| Molecular Formula | C19H12N6O7 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-1-phenyl-2-(2,4,6-trinitrophenyl)hydrazine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NN(c2ccccc2)c2nc3ccccc3o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N6O7/c26-23(27)13-10-15(24(28)29)18(16(11-13)25(30)31)21-22(12-6-2-1-3-7-12)19-20-14-8-4-5-9-17(14)32-19/h1-11,21H |
| InChIKey | VYDWOYDQPUKGNM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 170.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|