About 1,3-dinitrophenazine
1,3-dinitrophenazine (PubChem CID 78388402) has the molecular formula C12H6N4O4
and a molecular weight of 270.20 g/mol. Its IUPAC name is 1,3-dinitrophenazine.
Molecular Properties
| Compound Name | 1,3-dinitrophenazine |
| PubChem CID | 78388402 |
| Molecular Formula | C12H6N4O4 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1,3-dinitrophenazine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H6N4O4/c17-15(18)7-5-10-12(11(6-7)16(19)20)14-9-4-2-1-3-8(9)13-10/h1-6H |
| InChIKey | YHMYIFUNFCEUIM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dinitrophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dinitrophenazine?
The IUPAC name of 1,3-dinitrophenazine (CID 78388402) is 1,3-dinitrophenazine.
What is the SMILES notation for 1,3-dinitrophenazine?
The canonical SMILES for 1,3-dinitrophenazine is O=[N+]([O-])c1cc([N+](=O)[O-])c2nc3ccccc3nc2c1.
What is the InChIKey of 1,3-dinitrophenazine?
The InChIKey is YHMYIFUNFCEUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N4O4/c17-15(18)7-5-10-12(11(6-7)16(19)20)14-9-4-2-1-3-8(9)13-10/h1-6H.
What are the key properties of 1,3-dinitrophenazine?
1,3-dinitrophenazine has a molecular weight of 270.20 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dinitrophenazine is sourced from PubChem (CID 78388402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).