C13H9N5O7 — CID 71363503
1H-benzimidazole;2,4,6-trinitrophenol (PubChem CID 71363503) has the molecular formula C13H9N5O7 and a molecular weight of 347.24 g/mol. Its IUPAC name is 1H-benzimidazole;2,4,6-trinitrophenol.
| Compound Name | 1H-benzimidazole;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71363503 |
| Molecular Formula | C13H9N5O7 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1H-benzimidazole;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C6H3N3O7/c1-2-4-7-6(3-1)8-5-9-7;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-5H,(H,8,9);1-2,10H |
| InChIKey | VJWCRWWRNJNGGN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 178.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|