C13H10N6O7 — CID 71346533
benzimidazol-1-amine;2,4,6-trinitrophenol (PubChem CID 71346533) has the molecular formula C13H10N6O7 and a molecular weight of 362.26 g/mol. Its IUPAC name is benzimidazol-1-amine;2,4,6-trinitrophenol.
| Compound Name | benzimidazol-1-amine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71346533 |
| Molecular Formula | C13H10N6O7 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | benzimidazol-1-amine;2,4,6-trinitrophenol |
| SMILES | Nn1cnc2ccccc21.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H7N3.C6H3N3O7/c8-10-5-9-6-3-1-2-4-7(6)10;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-5H,8H2;1-2,10H |
| InChIKey | WWXOZQQAYQHWRU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 193.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|