C8H2Cl2N4O4 — CID 155490280
2,4-dichloro-6,8-dinitroquinazoline (PubChem CID 155490280) has the molecular formula C8H2Cl2N4O4 and a molecular weight of 289.03 g/mol. Its IUPAC name is 2,4-dichloro-6,8-dinitroquinazoline.
| Compound Name | 2,4-dichloro-6,8-dinitroquinazoline |
|---|---|
| PubChem CID | 155490280 |
| Molecular Formula | C8H2Cl2N4O4 |
| Molecular Weight | 289.03 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 2,4-dichloro-6,8-dinitroquinazoline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2nc(Cl)nc(Cl)c2c1 |
| InChI | InChI=1S/C8H2Cl2N4O4/c9-7-4-1-3(13(15)16)2-5(14(17)18)6(4)11-8(10)12-7/h1-2H |
| InChIKey | ZHVFLDFMXHLRBM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.03 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|