C12H4N4O8S2 — CID 19906745
1,3,7,9-tetranitrothianthrene (PubChem CID 19906745) has the molecular formula C12H4N4O8S2 and a molecular weight of 396.32 g/mol. Its IUPAC name is 1,3,7,9-tetranitrothianthrene.
| Compound Name | 1,3,7,9-tetranitrothianthrene |
|---|---|
| PubChem CID | 19906745 |
| Molecular Formula | C12H4N4O8S2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 1,3,7,9-tetranitrothianthrene |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)Sc1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])S2 |
| InChI | InChI=1S/C12H4N4O8S2/c17-13(18)5-1-7(15(21)22)11-9(3-5)25-10-4-6(14(19)20)2-8(16(23)24)12(10)26-11/h1-4H |
| InChIKey | LBNGTLMDXTZBBT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|