C12H5Cl2N3O4S — CID 121010122
1,3-dichloro-7,9-dinitro-10H-phenothiazine (PubChem CID 121010122) has the molecular formula C12H5Cl2N3O4S and a molecular weight of 358.16 g/mol. Its IUPAC name is 1,3-dichloro-7,9-dinitro-10H-phenothiazine.
| Compound Name | 1,3-dichloro-7,9-dinitro-10H-phenothiazine |
|---|---|
| PubChem CID | 121010122 |
| Molecular Formula | C12H5Cl2N3O4S |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 1,3-dichloro-7,9-dinitro-10H-phenothiazine |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)Nc1c(Cl)cc(Cl)cc1S2 |
| InChI | InChI=1S/C12H5Cl2N3O4S/c13-5-1-7(14)11-9(2-5)22-10-4-6(16(18)19)3-8(17(20)21)12(10)15-11/h1-4,15H |
| InChIKey | HILWMXKSMNHVLL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|