About 1,3-dichloro-7,9-dinitro-10H-phenothiazine
1,3-dichloro-7,9-dinitro-10H-phenothiazine (PubChem CID 121010122) has the molecular formula C12H5Cl2N3O4S
and a molecular weight of 358.16 g/mol. Its IUPAC name is 1,3-dichloro-7,9-dinitro-10H-phenothiazine.
Molecular Properties
| Compound Name | 1,3-dichloro-7,9-dinitro-10H-phenothiazine |
| PubChem CID | 121010122 |
| Molecular Formula | C12H5Cl2N3O4S |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 1,3-dichloro-7,9-dinitro-10H-phenothiazine |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)Nc1c(Cl)cc(Cl)cc1S2 |
| InChI | InChI=1S/C12H5Cl2N3O4S/c13-5-1-7(14)11-9(2-5)22-10-4-6(16(18)19)3-8(17(20)21)12(10)15-11/h1-4,15H |
| InChIKey | HILWMXKSMNHVLL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-7,9-dinitro-10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-7,9-dinitro-10H-phenothiazine?
The IUPAC name of 1,3-dichloro-7,9-dinitro-10H-phenothiazine (CID 121010122) is 1,3-dichloro-7,9-dinitro-10H-phenothiazine.
What is the SMILES notation for 1,3-dichloro-7,9-dinitro-10H-phenothiazine?
The canonical SMILES for 1,3-dichloro-7,9-dinitro-10H-phenothiazine is O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)Nc1c(Cl)cc(Cl)cc1S2.
What is the InChIKey of 1,3-dichloro-7,9-dinitro-10H-phenothiazine?
The InChIKey is HILWMXKSMNHVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl2N3O4S/c13-5-1-7(14)11-9(2-5)22-10-4-6(16(18)19)3-8(17(20)21)12(10)15-11/h1-4,15H.
What are the key properties of 1,3-dichloro-7,9-dinitro-10H-phenothiazine?
1,3-dichloro-7,9-dinitro-10H-phenothiazine has a molecular weight of 358.16 g/mol, XLogP of 5.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-7,9-dinitro-10H-phenothiazine is sourced from PubChem (CID 121010122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).