C14H11ClN2O2S — CID 10335338
7-chloro-1,3-dimethyl-9-nitro-10H-phenothiazine (PubChem CID 10335338) has the molecular formula C14H11ClN2O2S and a molecular weight of 306.77 g/mol. Its IUPAC name is 7-chloro-1,3-dimethyl-9-nitro-10H-phenothiazine.
| Compound Name | 7-chloro-1,3-dimethyl-9-nitro-10H-phenothiazine |
|---|---|
| PubChem CID | 10335338 |
| Molecular Formula | C14H11ClN2O2S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 7-chloro-1,3-dimethyl-9-nitro-10H-phenothiazine |
| SMILES | Cc1cc(C)c2c(c1)Sc1cc(Cl)cc([N+](=O)[O-])c1N2 |
| InChI | InChI=1S/C14H11ClN2O2S/c1-7-3-8(2)13-11(4-7)20-12-6-9(15)5-10(17(18)19)14(12)16-13/h3-6,16H,1-2H3 |
| InChIKey | WZHVJSAFSSKTAP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|