C15H14ClNO2S — CID 71389298
2-(5-chloro-2-nitrophenyl)sulfanyl-1,3,5-trimethylbenzene (PubChem CID 71389298) has the molecular formula C15H14ClNO2S and a molecular weight of 307.80 g/mol. Its IUPAC name is 2-(5-chloro-2-nitrophenyl)sulfanyl-1,3,5-trimethylbenzene.
| Compound Name | 2-(5-chloro-2-nitrophenyl)sulfanyl-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 71389298 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-(5-chloro-2-nitrophenyl)sulfanyl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(Sc2cc(Cl)ccc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C15H14ClNO2S/c1-9-6-10(2)15(11(3)7-9)20-14-8-12(16)4-5-13(14)17(18)19/h4-8H,1-3H3 |
| InChIKey | GCVCTNSGNHYQNU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|