C17H23NO2S — CID 145260631
2,4-dimethyl-1-(2-nitrophenyl)sulfanylbenzene;ethane;methane (PubChem CID 145260631) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2,4-dimethyl-1-(2-nitrophenyl)sulfanylbenzene;ethane;methane.
| Compound Name | 2,4-dimethyl-1-(2-nitrophenyl)sulfanylbenzene;ethane;methane |
|---|---|
| PubChem CID | 145260631 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2,4-dimethyl-1-(2-nitrophenyl)sulfanylbenzene;ethane;methane |
| SMILES | C.CC.Cc1ccc(Sc2ccccc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C14H13NO2S.C2H6.CH4/c1-10-7-8-13(11(2)9-10)18-14-6-4-3-5-12(14)15(16)17;1-2;/h3-9H,1-2H3;1-2H3;1H4 |
| InChIKey | DJYFKUOOQKNCFY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|