C25H26N2O2S — CID 71382967
N-(2-nitrophenyl)sulfanyl-1,1-bis(2,4,6-trimethylphenyl)methanimine (PubChem CID 71382967) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-(2-nitrophenyl)sulfanyl-1,1-bis(2,4,6-trimethylphenyl)methanimine.
| Compound Name | N-(2-nitrophenyl)sulfanyl-1,1-bis(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 71382967 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-(2-nitrophenyl)sulfanyl-1,1-bis(2,4,6-trimethylphenyl)methanimine |
| SMILES | Cc1cc(C)c(C(=NSc2ccccc2[N+](=O)[O-])c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C25H26N2O2S/c1-15-11-17(3)23(18(4)12-15)25(24-19(5)13-16(2)14-20(24)6)26-30-22-10-8-7-9-21(22)27(28)29/h7-14H,1-6H3 |
| InChIKey | LCQGZGVJJREENF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|