C8H5Cl3N2O2S — CID 44722590
(E)-2,2,2-trichloro-N-(2-nitrophenyl)sulfanylethanimine (PubChem CID 44722590) has the molecular formula C8H5Cl3N2O2S and a molecular weight of 299.57 g/mol. Its IUPAC name is (E)-2,2,2-trichloro-N-(2-nitrophenyl)sulfanylethanimine.
| Compound Name | (E)-2,2,2-trichloro-N-(2-nitrophenyl)sulfanylethanimine |
|---|---|
| PubChem CID | 44722590 |
| Molecular Formula | C8H5Cl3N2O2S |
| Molecular Weight | 299.57 g/mol |
| Exact Mass | 297.91 |
| IUPAC Name | (E)-2,2,2-trichloro-N-(2-nitrophenyl)sulfanylethanimine |
| SMILES | O=[N+]([O-])c1ccccc1S/N=C/C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H5Cl3N2O2S/c9-8(10,11)5-12-16-7-4-2-1-3-6(7)13(14)15/h1-5H/b12-5+ |
| InChIKey | FBQZLKZYHRLNEW-LFYBBSHMSA-N |
| XLogP | 4.04 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|