About S-(2-nitrophenyl) benzenecarbothioate
S-(2-nitrophenyl) benzenecarbothioate (PubChem CID 88807973) has the molecular formula C13H9NO3S
and a molecular weight of 259.29 g/mol. Its IUPAC name is S-(2-nitrophenyl) benzenecarbothioate.
Molecular Properties
| Compound Name | S-(2-nitrophenyl) benzenecarbothioate |
| PubChem CID | 88807973 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | S-(2-nitrophenyl) benzenecarbothioate |
| SMILES | O=C(Sc1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C13H9NO3S/c15-13(10-6-2-1-3-7-10)18-12-9-5-4-8-11(12)14(16)17/h1-9H |
| InChIKey | MWGRNHXZSKPREF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-nitrophenyl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-nitrophenyl) benzenecarbothioate?
The IUPAC name of S-(2-nitrophenyl) benzenecarbothioate (CID 88807973) is S-(2-nitrophenyl) benzenecarbothioate.
What is the SMILES notation for S-(2-nitrophenyl) benzenecarbothioate?
The canonical SMILES for S-(2-nitrophenyl) benzenecarbothioate is O=C(Sc1ccccc1[N+](=O)[O-])c1ccccc1.
What is the InChIKey of S-(2-nitrophenyl) benzenecarbothioate?
The InChIKey is MWGRNHXZSKPREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3S/c15-13(10-6-2-1-3-7-10)18-12-9-5-4-8-11(12)14(16)17/h1-9H.
What are the key properties of S-(2-nitrophenyl) benzenecarbothioate?
S-(2-nitrophenyl) benzenecarbothioate has a molecular weight of 259.29 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-nitrophenyl) benzenecarbothioate is sourced from PubChem (CID 88807973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).