C21H15NO4S — CID 6200519
(E)-3-hydroxy-2-(2-nitrophenyl)sulfanyl-1,3-diphenylprop-2-en-1-one (PubChem CID 6200519) has the molecular formula C21H15NO4S and a molecular weight of 377.42 g/mol. Its IUPAC name is (E)-3-hydroxy-2-(2-nitrophenyl)sulfanyl-1,3-diphenylprop-2-en-1-one.
| Compound Name | (E)-3-hydroxy-2-(2-nitrophenyl)sulfanyl-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6200519 |
| Molecular Formula | C21H15NO4S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (E)-3-hydroxy-2-(2-nitrophenyl)sulfanyl-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(Sc1ccccc1[N+](=O)[O-])=C(\O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15NO4S/c23-19(15-9-3-1-4-10-15)21(20(24)16-11-5-2-6-12-16)27-18-14-8-7-13-17(18)22(25)26/h1-14,23H/b21-19+ |
| InChIKey | JVHHKHLZGMXHOP-XUTLUUPISA-N |
| XLogP | 5.50 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|