C29H21NO5S — CID 39920908
[(E)-2-(2-nitrophenyl)sulfanyl-3-oxo-1,3-diphenylprop-1-enyl] 4-methylbenzoate (PubChem CID 39920908) has the molecular formula C29H21NO5S and a molecular weight of 495.56 g/mol. Its IUPAC name is [(E)-2-(2-nitrophenyl)sulfanyl-3-oxo-1,3-diphenylprop-1-enyl] 4-methylbenzoate.
| Compound Name | [(E)-2-(2-nitrophenyl)sulfanyl-3-oxo-1,3-diphenylprop-1-enyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 39920908 |
| Molecular Formula | C29H21NO5S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | [(E)-2-(2-nitrophenyl)sulfanyl-3-oxo-1,3-diphenylprop-1-enyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O/C(=C(/Sc2ccccc2[N+](=O)[O-])C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21NO5S/c1-20-16-18-23(19-17-20)29(32)35-27(22-12-6-3-7-13-22)28(26(31)21-10-4-2-5-11-21)36-25-15-9-8-14-24(25)30(33)34/h2-19H,1H3/b28-27+ |
| InChIKey | ZUIQQJYPHQRZRB-BYYHNAKLSA-N |
| XLogP | 7.10 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|