C29H23N3O3S2 — CID 15836822
[(2Z,4S,5R)-3-(4-methylphenyl)-2-(2-nitrophenyl)sulfanylimino-4-phenyl-1,3-thiazolidin-5-yl]-phenylmethanone (PubChem CID 15836822) has the molecular formula C29H23N3O3S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is [(2Z,4S,5R)-3-(4-methylphenyl)-2-(2-nitrophenyl)sulfanylimino-4-phenyl-1,3-thiazolidin-5-yl]-phenylmethanone.
| Compound Name | [(2Z,4S,5R)-3-(4-methylphenyl)-2-(2-nitrophenyl)sulfanylimino-4-phenyl-1,3-thiazolidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 15836822 |
| Molecular Formula | C29H23N3O3S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | [(2Z,4S,5R)-3-(4-methylphenyl)-2-(2-nitrophenyl)sulfanylimino-4-phenyl-1,3-thiazolidin-5-yl]-phenylmethanone |
| SMILES | Cc1ccc(N2/C(=N/Sc3ccccc3[N+](=O)[O-])S[C@@H](C(=O)c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23N3O3S2/c1-20-16-18-23(19-17-20)31-26(21-10-4-2-5-11-21)28(27(33)22-12-6-3-7-13-22)36-29(31)30-37-25-15-9-8-14-24(25)32(34)35/h2-19,26,28H,1H3/b30-29-/t26-,28+/m0/s1 |
| InChIKey | RRTMIEREBOYJLL-CYLGNLLTSA-N |
| XLogP | 7.51 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|