C15H14N2O2S — CID 12729317
(2R,3R)-2-methyl-1-(2-nitrophenyl)sulfanyl-3-phenylaziridine (PubChem CID 12729317) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is (2R,3R)-2-methyl-1-(2-nitrophenyl)sulfanyl-3-phenylaziridine.
| Compound Name | (2R,3R)-2-methyl-1-(2-nitrophenyl)sulfanyl-3-phenylaziridine |
|---|---|
| PubChem CID | 12729317 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (2R,3R)-2-methyl-1-(2-nitrophenyl)sulfanyl-3-phenylaziridine |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)N1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N2O2S/c1-11-15(12-7-3-2-4-8-12)16(11)20-14-10-6-5-9-13(14)17(18)19/h2-11,15H,1H3/t11-,15+,16?/m1/s1 |
| InChIKey | KOEBZSTVYFDNBP-LKCRCUOOSA-N |
| XLogP | 4.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|